C9H14Cl2N2O2 — CID 54434344
1,3-dichloro-5,5-di(propan-2-yl)imidazolidine-2,4-dione (PubChem CID 54434344) has the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.13 g/mol. Its IUPAC name is 1,3-dichloro-5,5-di(propan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 1,3-dichloro-5,5-di(propan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 54434344 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1,3-dichloro-5,5-di(propan-2-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)C1(C(C)C)C(=O)N(Cl)C(=O)N1Cl |
| InChI | InChI=1S/C9H14Cl2N2O2/c1-5(2)9(6(3)4)7(14)12(10)8(15)13(9)11/h5-6H,1-4H3 |
| InChIKey | WJRQQNHJWMZTRM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|