C27H24N2O5 — CID 54434410
(2,5-dihydroxypyrrol-1-yl) (2S)-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanoate (PubChem CID 54434410) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 54434410 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-[(2,2-diphenylacetyl)amino]-3-phenylpropanoate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)On1c(O)ccc1O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24N2O5/c30-23-16-17-24(31)29(23)34-27(33)22(18-19-10-4-1-5-11-19)28-26(32)25(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22,25,30-31H,18H2,(H,28,32)/t22-/m0/s1 |
| InChIKey | WJSSQGPQYOLHAD-QFIPXVFZSA-N |
| XLogP | 3.41 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |