C27H46O3S — CID 54434511
1-ethylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol (PubChem CID 54434511) has the molecular formula C27H46O3S and a molecular weight of 450.73 g/mol. Its IUPAC name is 1-ethylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol.
| Compound Name | 1-ethylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol |
|---|---|
| PubChem CID | 54434511 |
| Molecular Formula | C27H46O3S |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 1-ethylsulfonyl-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-ol |
| SMILES | CCS(=O)(=O)C(O)C=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C27H46O3S/c1-8-31(29,30)27(28)21-26(7)20-12-19-25(6)18-11-17-24(5)16-10-15-23(4)14-9-13-22(2)3/h13,15,17,19,21,27-28H,8-12,14,16,18,20H2,1-7H3 |
| InChIKey | WJUIYQGOZUCNSU-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|