About 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane
1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane (PubChem CID 54434580) has the molecular formula C5H4F4N4O10
and a molecular weight of 356.10 g/mol. Its IUPAC name is 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane.
Molecular Properties
| Compound Name | 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane |
| PubChem CID | 54434580 |
| Molecular Formula | C5H4F4N4O10 |
| Molecular Weight | 356.10 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane |
| SMILES | O=[N+]([O-])C(CF)(OC(F)(F)OC(CF)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H4F4N4O10/c6-1-3(10(14)15,11(16)17)22-5(8,9)23-4(2-7,12(18)19)13(20)21/h1-2H2 |
| InChIKey | WJVMYXIMJQBVIV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.10 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane?
The IUPAC name of 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane (CID 54434580) is 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane.
What is the SMILES notation for 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane?
The canonical SMILES for 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane is O=[N+]([O-])C(CF)(OC(F)(F)OC(CF)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane?
The InChIKey is WJVMYXIMJQBVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F4N4O10/c6-1-3(10(14)15,11(16)17)22-5(8,9)23-4(2-7,12(18)19)13(20)21/h1-2H2.
What are the key properties of 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane?
1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane has a molecular weight of 356.10 g/mol, XLogP of -0.08, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[difluoro-(2-fluoro-1,1-dinitroethoxy)methoxy]-2-fluoro-1,1-dinitroethane is sourced from PubChem (CID 54434580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).