C21H22 — CID 54435227
4-(5,6,7,8-tetrahydronaphthalen-1-yl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 54435227) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-1-yl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-1-yl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 54435227 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-1-yl)tricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | c1cc2c(c(-c3ccc4c(c3)C3CCC4C3)c1)CCCC2 |
| InChI | InChI=1S/C21H22/c1-2-6-18-14(4-1)5-3-7-19(18)17-10-11-20-15-8-9-16(12-15)21(20)13-17/h3,5,7,10-11,13,15-16H,1-2,4,6,8-9,12H2 |
| InChIKey | JKDGXGUGRHFPFB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |