C22H26ClN — CID 54435929
1-[3-[4-(4-chlorophenyl)phenyl]but-2-enyl]-2-methylpiperidine (PubChem CID 54435929) has the molecular formula C22H26ClN and a molecular weight of 339.91 g/mol. Its IUPAC name is 1-[3-[4-(4-chlorophenyl)phenyl]but-2-enyl]-2-methylpiperidine.
| Compound Name | 1-[3-[4-(4-chlorophenyl)phenyl]but-2-enyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 54435929 |
| Molecular Formula | C22H26ClN |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[3-[4-(4-chlorophenyl)phenyl]but-2-enyl]-2-methylpiperidine |
| SMILES | CC(=CCN1CCCCC1C)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H26ClN/c1-17(14-16-24-15-4-3-5-18(24)2)19-6-8-20(9-7-19)21-10-12-22(23)13-11-21/h6-14,18H,3-5,15-16H2,1-2H3 |
| InChIKey | WKSJAUIFKHAYBF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |