C19H16FN3O — CID 54436023
3-amino-6-[(2-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one (PubChem CID 54436023) has the molecular formula C19H16FN3O and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-amino-6-[(2-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 3-amino-6-[(2-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 54436023 |
| Molecular Formula | C19H16FN3O |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 3-amino-6-[(2-fluorophenyl)methylidene]-8,9-dihydro-7H-pyrido[2,1-b]quinazolin-11-one |
| SMILES | Nc1ccc2c(=O)n3c(nc2c1)C(=Cc1ccccc1F)CCC3 |
| InChI | InChI=1S/C19H16FN3O/c20-16-6-2-1-4-12(16)10-13-5-3-9-23-18(13)22-17-11-14(21)7-8-15(17)19(23)24/h1-2,4,6-8,10-11H,3,5,9,21H2 |
| InChIKey | WKTNSUNUZLVMRE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|