C22H24N2O8S — CID 54436123
3-(3,4-dimethoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-4-yl)-N-hydroxyhexanamide (PubChem CID 54436123) has the molecular formula C22H24N2O8S and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-4-yl)-N-hydroxyhexanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-4-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 54436123 |
| Molecular Formula | C22H24N2O8S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)sulfonyl-6-(1,3-dioxoisoindol-4-yl)-N-hydroxyhexanamide |
| SMILES | COc1ccc(S(=O)(=O)C(CCCc2cccc3c2C(=O)NC3=O)CC(=O)NO)cc1OC |
| InChI | InChI=1S/C22H24N2O8S/c1-31-17-10-9-15(11-18(17)32-2)33(29,30)14(12-19(25)24-28)7-3-5-13-6-4-8-16-20(13)22(27)23-21(16)26/h4,6,8-11,14,28H,3,5,7,12H2,1-2H3,(H,24,25)(H,23,26,27) |
| InChIKey | WKVMVSOUZAKCOX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|