C8H6Cl3F3O3 — CID 54436631
1,1,1-trichloro-3-(ethoxymethylidene)-5,5,5-trifluoropentane-2,4-dione (PubChem CID 54436631) has the molecular formula C8H6Cl3F3O3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1,1,1-trichloro-3-(ethoxymethylidene)-5,5,5-trifluoropentane-2,4-dione.
| Compound Name | 1,1,1-trichloro-3-(ethoxymethylidene)-5,5,5-trifluoropentane-2,4-dione |
|---|---|
| PubChem CID | 54436631 |
| Molecular Formula | C8H6Cl3F3O3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | 1,1,1-trichloro-3-(ethoxymethylidene)-5,5,5-trifluoropentane-2,4-dione |
| SMILES | CCOC=C(C(=O)C(F)(F)F)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H6Cl3F3O3/c1-2-17-3-4(5(15)7(9,10)11)6(16)8(12,13)14/h3H,2H2,1H3 |
| InChIKey | WLEQRVIEVUPVSQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|