About [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate
[2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate (PubChem CID 54436863) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate.
Molecular Properties
| Compound Name | [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate |
| PubChem CID | 54436863 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate |
| SMILES | CC(=O)OCC(=O)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C15H22O3/c1-11-6-5-9-15(3,4)14(11)8-7-13(17)10-18-12(2)16/h7-8H,5-6,9-10H2,1-4H3 |
| InChIKey | WLIMVVFILROZKK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate?
The IUPAC name of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate (CID 54436863) is [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate.
What is the SMILES notation for [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate?
The canonical SMILES for [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate is CC(=O)OCC(=O)C=CC1=C(C)CCCC1(C)C.
What is the InChIKey of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate?
The InChIKey is WLIMVVFILROZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-11-6-5-9-15(3,4)14(11)8-7-13(17)10-18-12(2)16/h7-8H,5-6,9-10H2,1-4H3.
What are the key properties of [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate?
[2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate has a molecular weight of 250.34 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-enyl] acetate is sourced from PubChem (CID 54436863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).