About 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine
1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine (PubChem CID 54437099) has the molecular formula C6H16N6
and a molecular weight of 172.24 g/mol. Its IUPAC name is 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine |
| PubChem CID | 54437099 |
| Molecular Formula | C6H16N6 |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NN/C(=N/C)NC |
| InChI | InChI=1S/C6H16N6/c1-7-5(8-2)11-12-6(9-3)10-4/h1-4H3,(H2,7,8,11)(H2,9,10,12) |
| InChIKey | WLMWHUKFSCDNOP-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine?
The IUPAC name of 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine (CID 54437099) is 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine.
What is the SMILES notation for 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine?
The canonical SMILES for 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine is C/N=C(\NC)NN/C(=N/C)NC.
What is the InChIKey of 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine?
The InChIKey is WLMWHUKFSCDNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N6/c1-7-5(8-2)11-12-6(9-3)10-4/h1-4H3,(H2,7,8,11)(H2,9,10,12).
What are the key properties of 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine?
1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine has a molecular weight of 172.24 g/mol, XLogP of -1.51, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(N,N'-dimethylcarbamimidoyl)amino]-2,3-dimethylguanidine is sourced from PubChem (CID 54437099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).