C14H25N3O4 — CID 54437495
prop-2-enyl (3R)-3-amino-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-oxobutanoate (PubChem CID 54437495) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is prop-2-enyl (3R)-3-amino-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-oxobutanoate.
| Compound Name | prop-2-enyl (3R)-3-amino-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 54437495 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | prop-2-enyl (3R)-3-amino-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-4-oxobutanoate |
| SMILES | C=CCOC(=O)C[C@@H](N)C(=O)N[C@H](C(=O)NC)C(C)(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-6-7-21-10(18)8-9(15)12(19)17-11(13(20)16-5)14(2,3)4/h6,9,11H,1,7-8,15H2,2-5H3,(H,16,20)(H,17,19)/t9-,11-/m1/s1 |
| InChIKey | WLTJFFPAPAHDFR-MWLCHTKSSA-N |
| XLogP | -0.29 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|