About 2-methoxyheptan-1-amine
2-methoxyheptan-1-amine (PubChem CID 54437910) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is 2-methoxyheptan-1-amine.
Molecular Properties
| Compound Name | 2-methoxyheptan-1-amine |
| PubChem CID | 54437910 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 2-methoxyheptan-1-amine |
| SMILES | CCCCCC(CN)OC |
| InChI | InChI=1S/C8H19NO/c1-3-4-5-6-8(7-9)10-2/h8H,3-7,9H2,1-2H3 |
| InChIKey | WMAGUWIAHCROKK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyheptan-1-amine?
The IUPAC name of 2-methoxyheptan-1-amine (CID 54437910) is 2-methoxyheptan-1-amine.
What is the SMILES notation for 2-methoxyheptan-1-amine?
The canonical SMILES for 2-methoxyheptan-1-amine is CCCCCC(CN)OC.
What is the InChIKey of 2-methoxyheptan-1-amine?
The InChIKey is WMAGUWIAHCROKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO/c1-3-4-5-6-8(7-9)10-2/h8H,3-7,9H2,1-2H3.
What are the key properties of 2-methoxyheptan-1-amine?
2-methoxyheptan-1-amine has a molecular weight of 145.25 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyheptan-1-amine is sourced from PubChem (CID 54437910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).