C19H24F3N5O3 — CID 54437913
tert-butyl 4-[4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]phenyl]piperazine-1-carboxylate (PubChem CID 54437913) has the molecular formula C19H24F3N5O3 and a molecular weight of 427.43 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54437913 |
| Molecular Formula | C19H24F3N5O3 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | tert-butyl 4-[4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(-n3cnn(CC(F)(F)F)c3=O)cc2)CC1 |
| InChI | InChI=1S/C19H24F3N5O3/c1-18(2,3)30-17(29)25-10-8-24(9-11-25)14-4-6-15(7-5-14)26-13-23-27(16(26)28)12-19(20,21)22/h4-7,13H,8-12H2,1-3H3 |
| InChIKey | WMAHHRMPZROGCV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|