About non-2-en-4-yl acetate
non-2-en-4-yl acetate (PubChem CID 54438194) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is non-2-en-4-yl acetate.
Molecular Properties
| Compound Name | non-2-en-4-yl acetate |
| PubChem CID | 54438194 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | non-2-en-4-yl acetate |
| SMILES | CC=CC(CCCCC)OC(C)=O |
| InChI | InChI=1S/C11H20O2/c1-4-6-7-9-11(8-5-2)13-10(3)12/h5,8,11H,4,6-7,9H2,1-3H3 |
| InChIKey | WMFDOJLPEUKEHZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze non-2-en-4-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-2-en-4-yl acetate?
The IUPAC name of non-2-en-4-yl acetate (CID 54438194) is non-2-en-4-yl acetate.
What is the SMILES notation for non-2-en-4-yl acetate?
The canonical SMILES for non-2-en-4-yl acetate is CC=CC(CCCCC)OC(C)=O.
What is the InChIKey of non-2-en-4-yl acetate?
The InChIKey is WMFDOJLPEUKEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-6-7-9-11(8-5-2)13-10(3)12/h5,8,11H,4,6-7,9H2,1-3H3.
What are the key properties of non-2-en-4-yl acetate?
non-2-en-4-yl acetate has a molecular weight of 184.28 g/mol, XLogP of 3.07, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for non-2-en-4-yl acetate is sourced from PubChem (CID 54438194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).