C8H10F5NO — CID 54438362
2-methyl-N-(3,3,4,4,4-pentafluorobutyl)prop-2-enamide (PubChem CID 54438362) has the molecular formula C8H10F5NO and a molecular weight of 231.16 g/mol. Its IUPAC name is 2-methyl-N-(3,3,4,4,4-pentafluorobutyl)prop-2-enamide.
| Compound Name | 2-methyl-N-(3,3,4,4,4-pentafluorobutyl)prop-2-enamide |
|---|---|
| PubChem CID | 54438362 |
| Molecular Formula | C8H10F5NO |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-methyl-N-(3,3,4,4,4-pentafluorobutyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F5NO/c1-5(2)6(15)14-4-3-7(9,10)8(11,12)13/h1,3-4H2,2H3,(H,14,15) |
| InChIKey | WMIAHLAMDVCWMF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|