About 10aH-pyrano[3,2-g]chromen-2-one
10aH-pyrano[3,2-g]chromen-2-one (PubChem CID 54438783) has the molecular formula C12H8O3
and a molecular weight of 200.19 g/mol. Its IUPAC name is 10aH-pyrano[3,2-g]chromen-2-one.
Molecular Properties
| Compound Name | 10aH-pyrano[3,2-g]chromen-2-one |
| PubChem CID | 54438783 |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 10aH-pyrano[3,2-g]chromen-2-one |
| SMILES | O=C1C=CC2=CC3=CC=COC3=CC2O1 |
| InChI | InChI=1S/C12H8O3/c13-12-4-3-9-6-8-2-1-5-14-10(8)7-11(9)15-12/h1-7,11H |
| InChIKey | WMPKSZHACVYLNF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10aH-pyrano[3,2-g]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10aH-pyrano[3,2-g]chromen-2-one?
The IUPAC name of 10aH-pyrano[3,2-g]chromen-2-one (CID 54438783) is 10aH-pyrano[3,2-g]chromen-2-one.
What is the SMILES notation for 10aH-pyrano[3,2-g]chromen-2-one?
The canonical SMILES for 10aH-pyrano[3,2-g]chromen-2-one is O=C1C=CC2=CC3=CC=COC3=CC2O1.
What is the InChIKey of 10aH-pyrano[3,2-g]chromen-2-one?
The InChIKey is WMPKSZHACVYLNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O3/c13-12-4-3-9-6-8-2-1-5-14-10(8)7-11(9)15-12/h1-7,11H.
What are the key properties of 10aH-pyrano[3,2-g]chromen-2-one?
10aH-pyrano[3,2-g]chromen-2-one has a molecular weight of 200.19 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10aH-pyrano[3,2-g]chromen-2-one is sourced from PubChem (CID 54438783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).