About cis-(1S,2R)-1-fluoro-2-methylcyclopropane
cis-(1S,2R)-1-fluoro-2-methylcyclopropane (PubChem CID 54439479) has the molecular formula C4H7F
and a molecular weight of 74.10 g/mol. Its IUPAC name is cis-(1S,2R)-1-fluoro-2-methylcyclopropane.
Molecular Properties
| Compound Name | cis-(1S,2R)-1-fluoro-2-methylcyclopropane |
| PubChem CID | 54439479 |
| Molecular Formula | C4H7F |
| Molecular Weight | 74.10 g/mol |
| Exact Mass | 74.05 |
| IUPAC Name | cis-(1S,2R)-1-fluoro-2-methylcyclopropane |
| SMILES | C[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C4H7F/c1-3-2-4(3)5/h3-4H,2H2,1H3/t3-,4+/m1/s1 |
| InChIKey | WNBMPCSKLWIYKM-DMTCNVIQSA-N |
| XLogP | 1.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.10 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cis-(1S,2R)-1-fluoro-2-methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-1-fluoro-2-methylcyclopropane?
The IUPAC name of cis-(1S,2R)-1-fluoro-2-methylcyclopropane (CID 54439479) is cis-(1S,2R)-1-fluoro-2-methylcyclopropane.
What is the SMILES notation for cis-(1S,2R)-1-fluoro-2-methylcyclopropane?
The canonical SMILES for cis-(1S,2R)-1-fluoro-2-methylcyclopropane is C[C@@H]1C[C@@H]1F.
What is the InChIKey of cis-(1S,2R)-1-fluoro-2-methylcyclopropane?
The InChIKey is WNBMPCSKLWIYKM-DMTCNVIQSA-N. The full InChI is InChI=1S/C4H7F/c1-3-2-4(3)5/h3-4H,2H2,1H3/t3-,4+/m1/s1.
What are the key properties of cis-(1S,2R)-1-fluoro-2-methylcyclopropane?
cis-(1S,2R)-1-fluoro-2-methylcyclopropane has a molecular weight of 74.10 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-1-fluoro-2-methylcyclopropane is sourced from PubChem (CID 54439479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).