C12H13ClN2O — CID 54439496
2-(chloromethyl)-3,5,7-trimethyl-1H-1,8-naphthyridin-4-one (PubChem CID 54439496) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-(chloromethyl)-3,5,7-trimethyl-1H-1,8-naphthyridin-4-one.
| Compound Name | 2-(chloromethyl)-3,5,7-trimethyl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 54439496 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(chloromethyl)-3,5,7-trimethyl-1H-1,8-naphthyridin-4-one |
| SMILES | Cc1cc(C)c2c(=O)c(C)c(CCl)[nH]c2n1 |
| InChI | InChI=1S/C12H13ClN2O/c1-6-4-7(2)14-12-10(6)11(16)8(3)9(5-13)15-12/h4H,5H2,1-3H3,(H,14,15,16) |
| InChIKey | WNBSAKKZFFIFKT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|