About heptadec-8-enylcarbamic acid
heptadec-8-enylcarbamic acid (PubChem CID 54440389) has the molecular formula C18H35NO2
and a molecular weight of 297.48 g/mol. Its IUPAC name is heptadec-8-enylcarbamic acid.
Molecular Properties
| Compound Name | heptadec-8-enylcarbamic acid |
| PubChem CID | 54440389 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | heptadec-8-enylcarbamic acid |
| SMILES | CCCCCCCCC=CCCCCCCCNC(=O)O |
| InChI | InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-18(20)21/h9-10,19H,2-8,11-17H2,1H3,(H,20,21) |
| InChIKey | WNRKMYWZPYBBQJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze heptadec-8-enylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadec-8-enylcarbamic acid?
The IUPAC name of heptadec-8-enylcarbamic acid (CID 54440389) is heptadec-8-enylcarbamic acid.
What is the SMILES notation for heptadec-8-enylcarbamic acid?
The canonical SMILES for heptadec-8-enylcarbamic acid is CCCCCCCCC=CCCCCCCCNC(=O)O.
What is the InChIKey of heptadec-8-enylcarbamic acid?
The InChIKey is WNRKMYWZPYBBQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-18(20)21/h9-10,19H,2-8,11-17H2,1H3,(H,20,21).
What are the key properties of heptadec-8-enylcarbamic acid?
heptadec-8-enylcarbamic acid has a molecular weight of 297.48 g/mol, XLogP of 5.90, 15 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptadec-8-enylcarbamic acid is sourced from PubChem (CID 54440389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).