About 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one
1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one (PubChem CID 54440467) has the molecular formula C24H41NO
and a molecular weight of 359.60 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one.
Molecular Properties
| Compound Name | 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one |
| PubChem CID | 54440467 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | CCCCCCCC1CCC(C(=O)C=CC(C)=CN2CCCCC2)CC1 |
| InChI | InChI=1S/C24H41NO/c1-3-4-5-6-8-11-22-13-15-23(16-14-22)24(26)17-12-21(2)20-25-18-9-7-10-19-25/h12,17,20,22-23H,3-11,13-16,18-19H2,1-2H3 |
| InChIKey | WNSWLCKNLQYXGX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one?
The IUPAC name of 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one (CID 54440467) is 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one.
What is the SMILES notation for 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one?
The canonical SMILES for 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one is CCCCCCCC1CCC(C(=O)C=CC(C)=CN2CCCCC2)CC1.
What is the InChIKey of 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one?
The InChIKey is WNSWLCKNLQYXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H41NO/c1-3-4-5-6-8-11-22-13-15-23(16-14-22)24(26)17-12-21(2)20-25-18-9-7-10-19-25/h12,17,20,22-23H,3-11,13-16,18-19H2,1-2H3.
What are the key properties of 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one?
1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one has a molecular weight of 359.60 g/mol, XLogP of 6.67, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-heptylcyclohexyl)-4-methyl-5-piperidin-1-ylpenta-2,4-dien-1-one is sourced from PubChem (CID 54440467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).