C41H26F6O4 — CID 54440553
1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-(2-methoxyphenyl)penta-2,4-dien-1-one (PubChem CID 54440553) has the molecular formula C41H26F6O4 and a molecular weight of 696.64 g/mol. Its IUPAC name is 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-(2-methoxyphenyl)penta-2,4-dien-1-one.
| Compound Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-(2-methoxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 54440553 |
| Molecular Formula | C41H26F6O4 |
| Molecular Weight | 696.64 g/mol |
| Exact Mass | 696.17 |
| IUPAC Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-(2-methoxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1ccccc1C=CC=CC(=O)c1ccc2c(c1)C(c1ccc(OC(F)=C(F)F)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C41H26F6O4/c1-49-36-13-7-3-9-25(36)8-2-6-12-35(48)26-14-23-32-31-10-4-5-11-33(31)41(34(32)24-26,27-15-19-29(20-16-27)50-39(46)37(42)43)28-17-21-30(22-18-28)51-40(47)38(44)45/h2-24H,1H3 |
| InChIKey | WNUHRBOZSPBTSW-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.64 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|