About ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate
ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate (PubChem CID 54440738) has the molecular formula C12H23NO5
and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate.
Molecular Properties
| Compound Name | ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate |
| PubChem CID | 54440738 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate |
| SMILES | [H]/N=C(/COCC(OCC)OCC)CC(=O)OCC |
| InChI | InChI=1S/C12H23NO5/c1-4-16-11(14)7-10(13)8-15-9-12(17-5-2)18-6-3/h12-13H,4-9H2,1-3H3/b13-10+ |
| InChIKey | WNXLITHMGVTKNY-JLHYYAGUSA-N |
| XLogP | 1.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate?
The IUPAC name of ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate (CID 54440738) is ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate.
What is the SMILES notation for ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate?
The canonical SMILES for ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate is [H]/N=C(/COCC(OCC)OCC)CC(=O)OCC.
What is the InChIKey of ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate?
The InChIKey is WNXLITHMGVTKNY-JLHYYAGUSA-N. The full InChI is InChI=1S/C12H23NO5/c1-4-16-11(14)7-10(13)8-15-9-12(17-5-2)18-6-3/h12-13H,4-9H2,1-3H3/b13-10+.
What are the key properties of ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate?
ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate has a molecular weight of 261.32 g/mol, XLogP of 1.38, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,2-diethoxyethoxy)-3-iminobutanoate is sourced from PubChem (CID 54440738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).