C22H20F24I2Si2 — CID 54440945
trimethyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluoro-1,16-diiodo-16-trimethylsilylhexadeca-1,15-dienyl)silane (PubChem CID 54440945) has the molecular formula C22H20F24I2Si2 and a molecular weight of 1050.33 g/mol. Its IUPAC name is trimethyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluoro-1,16-diiodo-16-trimethylsilylhexadeca-1,15-dienyl)silane.
| Compound Name | trimethyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluoro-1,16-diiodo-16-trimethylsilylhexadeca-1,15-dienyl)silane |
|---|---|
| PubChem CID | 54440945 |
| Molecular Formula | C22H20F24I2Si2 |
| Molecular Weight | 1050.33 g/mol |
| Exact Mass | 1049.88 |
| IUPAC Name | trimethyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-tetracosafluoro-1,16-diiodo-16-trimethylsilylhexadeca-1,15-dienyl)silane |
| SMILES | C[Si](C)(C)C(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C(I)[Si](C)(C)C |
| InChI | InChI=1S/C22H20F24I2Si2/c1-49(2,3)9(47)7-11(23,24)13(27,28)15(31,32)17(35,36)19(39,40)21(43,44)22(45,46)20(41,42)18(37,38)16(33,34)14(29,30)12(25,26)8-10(48)50(4,5)6/h7-8H,1-6H3 |
| InChIKey | WOAUFODNDYNDRY-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1050.33 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|