C25H40O7 — CID 54440971
7-(1,3-dioxolan-2-ylmethyl)-4,6-dihydroxy-5,9,13-trimethyl-15-propyl-1-oxacyclohexadeca-11,13-diene-2,10-dione (PubChem CID 54440971) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is 7-(1,3-dioxolan-2-ylmethyl)-4,6-dihydroxy-5,9,13-trimethyl-15-propyl-1-oxacyclohexadeca-11,13-diene-2,10-dione.
| Compound Name | 7-(1,3-dioxolan-2-ylmethyl)-4,6-dihydroxy-5,9,13-trimethyl-15-propyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
|---|---|
| PubChem CID | 54440971 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 7-(1,3-dioxolan-2-ylmethyl)-4,6-dihydroxy-5,9,13-trimethyl-15-propyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| SMILES | CCCC1C=C(C)C=CC(=O)C(C)CC(CC2OCCO2)C(O)C(C)C(O)CC(=O)OC1 |
| InChI | InChI=1S/C25H40O7/c1-5-6-19-11-16(2)7-8-21(26)17(3)12-20(13-24-30-9-10-31-24)25(29)18(4)22(27)14-23(28)32-15-19/h7-8,11,17-20,22,24-25,27,29H,5-6,9-10,12-15H2,1-4H3 |
| InChIKey | WOBGMCIDZIPPSV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |