C16H19N3O2 — CID 54441359
3-(benzylideneamino)-1-propyl-3a,4,6,6a-tetrahydrocyclopenta[d]imidazole-2,5-dione (PubChem CID 54441359) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-(benzylideneamino)-1-propyl-3a,4,6,6a-tetrahydrocyclopenta[d]imidazole-2,5-dione.
| Compound Name | 3-(benzylideneamino)-1-propyl-3a,4,6,6a-tetrahydrocyclopenta[d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 54441359 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-(benzylideneamino)-1-propyl-3a,4,6,6a-tetrahydrocyclopenta[d]imidazole-2,5-dione |
| SMILES | CCCN1C(=O)N(N=Cc2ccccc2)C2CC(=O)CC21 |
| InChI | InChI=1S/C16H19N3O2/c1-2-8-18-14-9-13(20)10-15(14)19(16(18)21)17-11-12-6-4-3-5-7-12/h3-7,11,14-15H,2,8-10H2,1H3 |
| InChIKey | WOIGHICYYJYALM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|