About methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate
methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate (PubChem CID 54441712) has the molecular formula C21H24O4
and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate |
| PubChem CID | 54441712 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate |
| SMILES | COC(=O)C(OC1CCCCO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O4/c1-23-21(22)20(25-18-14-8-9-15-24-18)19(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-7,10-13,18-20H,8-9,14-15H2,1H3 |
| InChIKey | WOOGTEFKYOVYNR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate?
The IUPAC name of methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate (CID 54441712) is methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate.
What is the SMILES notation for methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate?
The canonical SMILES for methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate is COC(=O)C(OC1CCCCO1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate?
The InChIKey is WOOGTEFKYOVYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O4/c1-23-21(22)20(25-18-14-8-9-15-24-18)19(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-7,10-13,18-20H,8-9,14-15H2,1H3.
What are the key properties of methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate?
methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate has a molecular weight of 340.42 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(oxan-2-yloxy)-3,3-diphenylpropanoate is sourced from PubChem (CID 54441712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).