C6H12O4S — CID 54442234
(2R)-1,2,4-trihydroxy-5-methylsulfanylpentan-3-one (PubChem CID 54442234) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is (2R)-1,2,4-trihydroxy-5-methylsulfanylpentan-3-one.
| Compound Name | (2R)-1,2,4-trihydroxy-5-methylsulfanylpentan-3-one |
|---|---|
| PubChem CID | 54442234 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (2R)-1,2,4-trihydroxy-5-methylsulfanylpentan-3-one |
| SMILES | CSCC(O)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O4S/c1-11-3-5(9)6(10)4(8)2-7/h4-5,7-9H,2-3H2,1H3/t4-,5?/m1/s1 |
| InChIKey | WOYBZAKPKWXIHT-CNZKWPKMSA-N |
| XLogP | -1.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |