C24H31FN2O2 — CID 54442390
4-(4-fluorophenyl)-5-(3-oxopropyl)-2,6-di(propan-2-yl)-N-propylpyridine-3-carboxamide (PubChem CID 54442390) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(3-oxopropyl)-2,6-di(propan-2-yl)-N-propylpyridine-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-5-(3-oxopropyl)-2,6-di(propan-2-yl)-N-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 54442390 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(3-oxopropyl)-2,6-di(propan-2-yl)-N-propylpyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1c(C(C)C)nc(C(C)C)c(CCC=O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H31FN2O2/c1-6-13-26-24(29)21-20(17-9-11-18(25)12-10-17)19(8-7-14-28)22(15(2)3)27-23(21)16(4)5/h9-12,14-16H,6-8,13H2,1-5H3,(H,26,29) |
| InChIKey | WPAVVPUNMPKJIW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|