About diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate
diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate (PubChem CID 54442826) has the molecular formula C31H38F2O6
and a molecular weight of 544.64 g/mol. Its IUPAC name is diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate |
| PubChem CID | 54442826 |
| Molecular Formula | C31H38F2O6 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc(C(=O)C(C)(C)C)cc1F)(Cc1ccc(C(=O)C(C)(C)C)cc1F)C(=O)OCC |
| InChI | InChI=1S/C31H38F2O6/c1-9-38-27(36)31(28(37)39-10-2,17-21-13-11-19(15-23(21)32)25(34)29(3,4)5)18-22-14-12-20(16-24(22)33)26(35)30(6,7)8/h11-16H,9-10,17-18H2,1-8H3 |
| InChIKey | WPIRLWGFFXOXQT-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate?
The IUPAC name of diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate (CID 54442826) is diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate.
What is the SMILES notation for diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate?
The canonical SMILES for diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate is CCOC(=O)C(Cc1ccc(C(=O)C(C)(C)C)cc1F)(Cc1ccc(C(=O)C(C)(C)C)cc1F)C(=O)OCC.
What is the InChIKey of diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate?
The InChIKey is WPIRLWGFFXOXQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38F2O6/c1-9-38-27(36)31(28(37)39-10-2,17-21-13-11-19(15-23(21)32)25(34)29(3,4)5)18-22-14-12-20(16-24(22)33)26(35)30(6,7)8/h11-16H,9-10,17-18H2,1-8H3.
What are the key properties of diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate?
diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate has a molecular weight of 544.64 g/mol, XLogP of 6.32, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,2-bis[[4-(2,2-dimethylpropanoyl)-2-fluorophenyl]methyl]propanedioate is sourced from PubChem (CID 54442826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).