C29H44N4O5 — CID 54442856
3,3-dimethylbutan-2-yl 2-[2-acetamido-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]acetate (PubChem CID 54442856) has the molecular formula C29H44N4O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl 2-[2-acetamido-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]acetate.
| Compound Name | 3,3-dimethylbutan-2-yl 2-[2-acetamido-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 54442856 |
| Molecular Formula | C29H44N4O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | 3,3-dimethylbutan-2-yl 2-[2-acetamido-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]acetate |
| SMILES | CC(=O)NC1=Nc2ccc(OCCCC(=O)N(C)C3CCCCC3)cc2CN1CC(=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C29H44N4O5/c1-20(29(3,4)5)38-27(36)19-33-18-22-17-24(14-15-25(22)31-28(33)30-21(2)34)37-16-10-13-26(35)32(6)23-11-8-7-9-12-23/h14-15,17,20,23H,7-13,16,18-19H2,1-6H3,(H,30,31,34) |
| InChIKey | WPJJCNILDLVTJH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|