About 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene
10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene (PubChem CID 54443502) has the molecular formula C32H60O3
and a molecular weight of 492.83 g/mol. Its IUPAC name is 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene.
Molecular Properties
| Compound Name | 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene |
| PubChem CID | 54443502 |
| Molecular Formula | C32H60O3 |
| Molecular Weight | 492.83 g/mol |
| Exact Mass | 492.45 |
| IUPAC Name | 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene |
| SMILES | C=CCCCCCCCCOC(C)(OCCCCCCCCC=C)OCCCCCCCCC=C |
| InChI | InChI=1S/C32H60O3/c1-5-8-11-14-17-20-23-26-29-33-32(4,34-30-27-24-21-18-15-12-9-6-2)35-31-28-25-22-19-16-13-10-7-3/h5-7H,1-3,8-31H2,4H3 |
| InChIKey | WPUPWLPLDMTMML-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.83 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene?
The IUPAC name of 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene (CID 54443502) is 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene.
What is the SMILES notation for 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene?
The canonical SMILES for 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene is C=CCCCCCCCCOC(C)(OCCCCCCCCC=C)OCCCCCCCCC=C.
What is the InChIKey of 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene?
The InChIKey is WPUPWLPLDMTMML-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H60O3/c1-5-8-11-14-17-20-23-26-29-33-32(4,34-30-27-24-21-18-15-12-9-6-2)35-31-28-25-22-19-16-13-10-7-3/h5-7H,1-3,8-31H2,4H3.
What are the key properties of 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene?
10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene has a molecular weight of 492.83 g/mol, XLogP of 10.46, 30 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[1,1-bis(dec-9-enoxy)ethoxy]dec-1-ene is sourced from PubChem (CID 54443502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).