About 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone
1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone (PubChem CID 54443701) has the molecular formula C24H18Cl2N2O3S
and a molecular weight of 485.39 g/mol. Its IUPAC name is 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone |
| PubChem CID | 54443701 |
| Molecular Formula | C24H18Cl2N2O3S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1c(-c2ccc(Cl)cc2)nn(-c2ccc(S(C)(=O)=O)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18Cl2N2O3S/c1-15(29)22-23(16-3-7-18(25)8-4-16)27-28(24(22)17-5-9-19(26)10-6-17)20-11-13-21(14-12-20)32(2,30)31/h3-14H,1-2H3 |
| InChIKey | WPYLZQPSQZWNBK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone?
The IUPAC name of 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone (CID 54443701) is 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone.
What is the SMILES notation for 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone?
The canonical SMILES for 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone is CC(=O)c1c(-c2ccc(Cl)cc2)nn(-c2ccc(S(C)(=O)=O)cc2)c1-c1ccc(Cl)cc1.
What is the InChIKey of 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone?
The InChIKey is WPYLZQPSQZWNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18Cl2N2O3S/c1-15(29)22-23(16-3-7-18(25)8-4-16)27-28(24(22)17-5-9-19(26)10-6-17)20-11-13-21(14-12-20)32(2,30)31/h3-14H,1-2H3.
What are the key properties of 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone?
1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone has a molecular weight of 485.39 g/mol, XLogP of 6.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(4-chlorophenyl)-1-(4-methylsulfonylphenyl)pyrazol-4-yl]ethanone is sourced from PubChem (CID 54443701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).