C20H22O6 — CID 54443769
4-methoxy-6-[2-(3-methoxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-2,2-dimethylcyclohex-4-ene-1,3-dione (PubChem CID 54443769) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-methoxy-6-[2-(3-methoxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-2,2-dimethylcyclohex-4-ene-1,3-dione.
| Compound Name | 4-methoxy-6-[2-(3-methoxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-2,2-dimethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 54443769 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-methoxy-6-[2-(3-methoxy-5,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)ethylidene]-2,2-dimethylcyclohex-4-ene-1,3-dione |
| SMILES | COC1=CC(=CC=C2C=C(OC)C(=O)C(C)(C)C2=O)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C20H22O6/c1-19(2)15(21)11(9-13(25-5)17(19)23)7-8-12-10-14(26-6)18(24)20(3,4)16(12)22/h7-10H,1-6H3 |
| InChIKey | WPZWGXQOHSGIKR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|