About 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid
2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid (PubChem CID 54443792) has the molecular formula C8H18N2O4S
and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid |
| PubChem CID | 54443792 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C8H18N2O4S/c1-3-6(2)7(9)8(11)10-4-5-15(12,13)14/h6-7H,3-5,9H2,1-2H3,(H,10,11)(H,12,13,14)/t6-,7-/m0/s1 |
| InChIKey | WQAIVLVCLNQTJB-BQBZGAKWSA-N |
| XLogP | -0.64 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid?
The IUPAC name of 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid (CID 54443792) is 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid.
What is the SMILES notation for 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid?
The canonical SMILES for 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid is CC[C@H](C)[C@H](N)C(=O)NCCS(=O)(=O)O.
What is the InChIKey of 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid?
The InChIKey is WQAIVLVCLNQTJB-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H18N2O4S/c1-3-6(2)7(9)8(11)10-4-5-15(12,13)14/h6-7H,3-5,9H2,1-2H3,(H,10,11)(H,12,13,14)/t6-,7-/m0/s1.
What are the key properties of 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid?
2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid has a molecular weight of 238.31 g/mol, XLogP of -0.64, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]ethanesulfonic acid is sourced from PubChem (CID 54443792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).