C15H21NO5 — CID 54445606
dimethyl 2-[[2-(aminomethyl)-4-methoxyphenyl]methyl]butanedioate (PubChem CID 54445606) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is dimethyl 2-[[2-(aminomethyl)-4-methoxyphenyl]methyl]butanedioate.
| Compound Name | dimethyl 2-[[2-(aminomethyl)-4-methoxyphenyl]methyl]butanedioate |
|---|---|
| PubChem CID | 54445606 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | dimethyl 2-[[2-(aminomethyl)-4-methoxyphenyl]methyl]butanedioate |
| SMILES | COC(=O)CC(Cc1ccc(OC)cc1CN)C(=O)OC |
| InChI | InChI=1S/C15H21NO5/c1-19-13-5-4-10(12(7-13)9-16)6-11(15(18)21-3)8-14(17)20-2/h4-5,7,11H,6,8-9,16H2,1-3H3 |
| InChIKey | WRGXNOYTSDSOEX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |