About [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate
[2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate (PubChem CID 54445749) has the molecular formula C19H17N5O5
and a molecular weight of 395.38 g/mol. Its IUPAC name is [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate.
Molecular Properties
| Compound Name | [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate |
| PubChem CID | 54445749 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-n2cnc(NNc3ccccc3)nc2=O)cc1OC(C)=O |
| InChI | InChI=1S/C19H17N5O5/c1-12(25)28-16-9-8-15(10-17(16)29-13(2)26)24-11-20-18(21-19(24)27)23-22-14-6-4-3-5-7-14/h3-11,22H,1-2H3,(H,21,23,27) |
| InChIKey | WRJMPRQONCUKQG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate?
The IUPAC name of [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate (CID 54445749) is [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate.
What is the SMILES notation for [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate?
The canonical SMILES for [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate is CC(=O)Oc1ccc(-n2cnc(NNc3ccccc3)nc2=O)cc1OC(C)=O.
What is the InChIKey of [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate?
The InChIKey is WRJMPRQONCUKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O5/c1-12(25)28-16-9-8-15(10-17(16)29-13(2)26)24-11-20-18(21-19(24)27)23-22-14-6-4-3-5-7-14/h3-11,22H,1-2H3,(H,21,23,27).
What are the key properties of [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate?
[2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate has a molecular weight of 395.38 g/mol, XLogP of 1.92, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2-acetyloxy-4-[2-oxo-4-(2-phenylhydrazinyl)-1,3,5-triazin-1-yl]phenyl] acetate is sourced from PubChem (CID 54445749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).