C23H44N8O5 — CID 54445785
tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-[1-(dimethylamino)ethenylamino]-1-oxohexan-2-yl]carbamate (PubChem CID 54445785) has the molecular formula C23H44N8O5 and a molecular weight of 512.66 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-[1-(dimethylamino)ethenylamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-[1-(dimethylamino)ethenylamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 54445785 |
| Molecular Formula | C23H44N8O5 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-6-[1-(dimethylamino)ethenylamino]-1-oxohexan-2-yl]carbamate |
| SMILES | C=C(NCCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)N[C@H](C=O)CCCN=C(N)N)N(C)C |
| InChI | InChI=1S/C23H44N8O5/c1-16(31(5)6)26-12-8-7-11-18(30-22(35)36-23(2,3)4)20(34)28-14-19(33)29-17(15-32)10-9-13-27-21(24)25/h15,17-18,26H,1,7-14H2,2-6H3,(H,28,34)(H,29,33)(H,30,35)(H4,24,25,27)/t17-,18+/m0/s1 |
| InChIKey | WRKCGVQKMWZHNG-ZWKOTPCHSA-N |
| XLogP | -0.47 |
| TPSA | 193.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|