C9H19NO3 — CID 54446615
(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxyamino]butanoic acid (PubChem CID 54446615) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxyamino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxyamino]butanoic acid |
|---|---|
| PubChem CID | 54446615 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxyamino]butanoic acid |
| SMILES | CC(C)[C@H](NOC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H19NO3/c1-6(2)7(8(11)12)10-13-9(3,4)5/h6-7,10H,1-5H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | WRYUMJBAAOFMSJ-ZETCQYMHSA-N |
| XLogP | 1.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|