C17H15N7O8S3 — CID 54446969
5-[[(6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methylsulfanyl]-1,3,4-oxadiazole-2-carboxylic acid (PubChem CID 54446969) has the molecular formula C17H15N7O8S3 and a molecular weight of 541.55 g/mol. Its IUPAC name is 5-[[(6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methylsulfanyl]-1,3,4-oxadiazole-2-carboxylic acid.
| Compound Name | 5-[[(6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methylsulfanyl]-1,3,4-oxadiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 54446969 |
| Molecular Formula | C17H15N7O8S3 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | 5-[[(6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methylsulfanyl]-1,3,4-oxadiazole-2-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSc3nnc(C(=O)O)o3)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C17H15N7O8S3/c1-31-23-7(6-4-34-16(18)19-6)10(25)20-8-12(26)24-9(14(27)28)5(2-33-13(8)24)3-35-17-22-21-11(32-17)15(29)30/h4,8,13H,2-3H2,1H3,(H2,18,19)(H,20,25)(H,27,28)(H,29,30)/t8-,13+/m1/s1 |
| InChIKey | WSFAFIHRVURTKT-OQPBUACISA-N |
| XLogP | -0.31 |
| TPSA | 223.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|