About 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one
6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one (PubChem CID 54446978) has the molecular formula C12H21N5O2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one |
| PubChem CID | 54446978 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one |
| SMILES | NCCCCCC(=O)C(CN)Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C12H21N5O2/c13-6-3-1-2-4-10(18)9(8-14)16-11-5-7-15-12(19)17-11/h5,7,9H,1-4,6,8,13-14H2,(H2,15,16,17,19) |
| InChIKey | WSFFHKJRAHMSGG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one?
The IUPAC name of 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one (CID 54446978) is 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one.
What is the SMILES notation for 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one?
The canonical SMILES for 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one is NCCCCCC(=O)C(CN)Nc1ccnc(=O)[nH]1.
What is the InChIKey of 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one?
The InChIKey is WSFFHKJRAHMSGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O2/c13-6-3-1-2-4-10(18)9(8-14)16-11-5-7-15-12(19)17-11/h5,7,9H,1-4,6,8,13-14H2,(H2,15,16,17,19).
What are the key properties of 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one?
6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one has a molecular weight of 267.33 g/mol, XLogP of -0.40, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1,8-diamino-3-oxooctan-2-yl)amino]-1H-pyrimidin-2-one is sourced from PubChem (CID 54446978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).