About 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one
5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one (PubChem CID 54448475) has the molecular formula C7H8ClNO2
and a molecular weight of 173.60 g/mol. Its IUPAC name is 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one |
| PubChem CID | 54448475 |
| Molecular Formula | C7H8ClNO2 |
| Molecular Weight | 173.60 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one |
| SMILES | Cc1cc(=O)n(C)c(O)c1Cl |
| InChI | InChI=1S/C7H8ClNO2/c1-4-3-5(10)9(2)7(11)6(4)8/h3,11H,1-2H3 |
| InChIKey | LUGXHNSUBXCUSY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.60 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one?
The IUPAC name of 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one (CID 54448475) is 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one.
What is the SMILES notation for 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one?
The canonical SMILES for 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one is Cc1cc(=O)n(C)c(O)c1Cl.
What is the InChIKey of 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one?
The InChIKey is LUGXHNSUBXCUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO2/c1-4-3-5(10)9(2)7(11)6(4)8/h3,11H,1-2H3.
What are the key properties of 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one?
5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one has a molecular weight of 173.60 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-hydroxy-1,4-dimethylpyridin-2-one is sourced from PubChem (CID 54448475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).