About 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene
5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene (PubChem CID 54448977) has the molecular formula C8H6O2
and a molecular weight of 134.13 g/mol. Its IUPAC name is 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene.
Analyze 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene?
The IUPAC name of 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene (CID 54448977) is 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene.
What is the SMILES notation for 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene?
The canonical SMILES for 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene is c1cc2c3c(c1CO3)CO2.
What is the InChIKey of 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene?
The InChIKey is HOJRLKKNTIGHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2/c1-2-7-8-6(4-9-7)5(1)3-10-8/h1-2H,3-4H2.
What are the key properties of 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene?
5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene has a molecular weight of 134.13 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dioxatricyclo[5.3.0.04,8]deca-1(7),2,4(8)-triene is sourced from PubChem (CID 54448977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).