C28H54O3Si2 — CID 54449552
(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-prop-2-enylcyclopentan-1-one (PubChem CID 54449552) has the molecular formula C28H54O3Si2 and a molecular weight of 494.91 g/mol. Its IUPAC name is (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-prop-2-enylcyclopentan-1-one.
| Compound Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 54449552 |
| Molecular Formula | C28H54O3Si2 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | (2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C=C[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O3Si2/c1-13-15-16-18-22(30-32(9,10)27(3,4)5)19-20-24-23(17-14-2)25(29)21-26(24)31-33(11,12)28(6,7)8/h14,19-20,22-24,26H,2,13,15-18,21H2,1,3-12H3/t22-,23+,24+,26+/m0/s1 |
| InChIKey | WTYNJHCLEIRPLT-POMLREGLSA-N |
| XLogP | 8.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|