C21H30O — CID 54449575
(10R,12R)-17-ethenyl-10,12-dimethyl-1,2,3,6,7,8,9,11,12,13,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 54449575) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (10R,12R)-17-ethenyl-10,12-dimethyl-1,2,3,6,7,8,9,11,12,13,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (10R,12R)-17-ethenyl-10,12-dimethyl-1,2,3,6,7,8,9,11,12,13,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54449575 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (10R,12R)-17-ethenyl-10,12-dimethyl-1,2,3,6,7,8,9,11,12,13,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C=CC1=CCC2C3CCC4=CC(O)CC[C@]4(C)C3C[C@@H](C)C12 |
| InChI | InChI=1S/C21H30O/c1-4-14-5-7-18-17-8-6-15-12-16(22)9-10-21(15,3)19(17)11-13(2)20(14)18/h4-5,12-13,16-20,22H,1,6-11H2,2-3H3/t13-,16?,17?,18?,19?,20?,21+/m1/s1 |
| InChIKey | WTYVZWJHPOLPES-KSQQSVGJSA-N |
| XLogP | 4.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|