C12H3F21 — CID 54450111
5-ethenyl-1,1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane (PubChem CID 54450111) has the molecular formula C12H3F21 and a molecular weight of 546.11 g/mol. Its IUPAC name is 5-ethenyl-1,1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane.
| Compound Name | 5-ethenyl-1,1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
|---|---|
| PubChem CID | 54450111 |
| Molecular Formula | C12H3F21 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.99 |
| IUPAC Name | 5-ethenyl-1,1,1,2,2,3,3,4,4,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
| SMILES | C=CC(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F21/c1-2-3(13,5(16,17)7(20,21)9(24,25)11(28,29)30)4(14,15)6(18,19)8(22,23)10(26,27)12(31,32)33/h2H,1H2 |
| InChIKey | WUIZJUXSZVKEDH-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|