About (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine
(Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine (PubChem CID 54450222) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine.
Molecular Properties
| Compound Name | (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine |
| PubChem CID | 54450222 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine |
| SMILES | C/C(=N/OCC1OCCO1)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H17NO3/c1-10-3-5-12(6-4-10)11(2)14-17-9-13-15-7-8-16-13/h3-6,13H,7-9H2,1-2H3/b14-11- |
| InChIKey | WULBCNLSFDEIDQ-KAMYIIQDSA-N |
| XLogP | 2.11 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine?
The IUPAC name of (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine (CID 54450222) is (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine.
What is the SMILES notation for (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine?
The canonical SMILES for (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine is C/C(=N/OCC1OCCO1)c1ccc(C)cc1.
What is the InChIKey of (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine?
The InChIKey is WULBCNLSFDEIDQ-KAMYIIQDSA-N. The full InChI is InChI=1S/C13H17NO3/c1-10-3-5-12(6-4-10)11(2)14-17-9-13-15-7-8-16-13/h3-6,13H,7-9H2,1-2H3/b14-11-.
What are the key properties of (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine?
(Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine has a molecular weight of 235.28 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(1,3-dioxolan-2-ylmethoxy)-1-(4-methylphenyl)ethanimine is sourced from PubChem (CID 54450222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).