C25H35N7O2 — CID 54450571
(2S,6R)-4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-(2,5,6-trimethylbenzimidazol-1-yl)-1,3,5-triazin-2-yl]-2,6-dimethylmorpholine (PubChem CID 54450571) has the molecular formula C25H35N7O2 and a molecular weight of 465.60 g/mol. Its IUPAC name is (2S,6R)-4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-(2,5,6-trimethylbenzimidazol-1-yl)-1,3,5-triazin-2-yl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-(2,5,6-trimethylbenzimidazol-1-yl)-1,3,5-triazin-2-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 54450571 |
| Molecular Formula | C25H35N7O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | (2S,6R)-4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-6-(2,5,6-trimethylbenzimidazol-1-yl)-1,3,5-triazin-2-yl]-2,6-dimethylmorpholine |
| SMILES | Cc1cc2nc(C)n(-c3nc(N4C[C@@H](C)O[C@@H](C)C4)nc(N4C[C@@H](C)O[C@@H](C)C4)n3)c2cc1C |
| InChI | InChI=1S/C25H35N7O2/c1-14-8-21-22(9-15(14)2)32(20(7)26-21)25-28-23(30-10-16(3)33-17(4)11-30)27-24(29-25)31-12-18(5)34-19(6)13-31/h8-9,16-19H,10-13H2,1-7H3/t16-,17+,18-,19+ |
| InChIKey | WURIHNXEAPMHDB-QGFMHUBQSA-N |
| XLogP | 3.36 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |