C19H18BrN3O2 — CID 54450709
(7S)-14-bromo-5-(3-hydroxy-3-methylbut-1-ynyl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one (PubChem CID 54450709) has the molecular formula C19H18BrN3O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is (7S)-14-bromo-5-(3-hydroxy-3-methylbut-1-ynyl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one.
| Compound Name | (7S)-14-bromo-5-(3-hydroxy-3-methylbut-1-ynyl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one |
|---|---|
| PubChem CID | 54450709 |
| Molecular Formula | C19H18BrN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | (7S)-14-bromo-5-(3-hydroxy-3-methylbut-1-ynyl)-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaen-12-one |
| SMILES | CC(C)(O)C#Cc1ncn2c1[C@@H]1CCCN1C(=O)c1c(Br)cccc1-2 |
| InChI | InChI=1S/C19H18BrN3O2/c1-19(2,25)9-8-13-17-15-7-4-10-22(15)18(24)16-12(20)5-3-6-14(16)23(17)11-21-13/h3,5-6,11,15,25H,4,7,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | WUTRSHVYXGERHS-HNNXBMFYSA-N |
| XLogP | 3.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|