About 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide
1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide (PubChem CID 54450901) has the molecular formula C9H22NO5PS
and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide |
| PubChem CID | 54450901 |
| Molecular Formula | C9H22NO5PS |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide |
| SMILES | CCOP(=O)(CS(=O)(=O)N(CC)CC)OCC |
| InChI | InChI=1S/C9H22NO5PS/c1-5-10(6-2)17(12,13)9-16(11,14-7-3)15-8-4/h5-9H2,1-4H3 |
| InChIKey | WUXDIDCQJFIJAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide?
The IUPAC name of 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide (CID 54450901) is 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide.
What is the SMILES notation for 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide?
The canonical SMILES for 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide is CCOP(=O)(CS(=O)(=O)N(CC)CC)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide?
The InChIKey is WUXDIDCQJFIJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22NO5PS/c1-5-10(6-2)17(12,13)9-16(11,14-7-3)15-8-4/h5-9H2,1-4H3.
What are the key properties of 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide?
1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide has a molecular weight of 287.32 g/mol, XLogP of 1.88, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-N,N-diethylmethanesulfonamide is sourced from PubChem (CID 54450901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).